On Target OPRD_HUMAN 0.42352942/CHEMBL401508
For the given ligand Fosinopril, we have found in our database that, being scored 0.42352942, the most similar ligand is CHEMBL401508. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL401508 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | C[C@H]1CN(CCC(=O)N[C@@H](CC2CCCCC2)C(=O)O)CC[C@@]1(C)c3cccc(O)c3 |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00010000 43005608 20100100 00010600 00080080 40000000 02000000 20000000 00000800 000809e0 08300000 5001b000 0e00800a 00800000 80080000 000c0008 10000000 02000000 02402010 00020201 00000100 18040e10 03000000 00500018 00001000 80000000 00000000 10000000 00000000 0006001b 20024000 00002600 |