On Target OPRD_HUMAN 0.6460177/CHEMBL3912914
For the given ligand Ramipril, we have found in our database that, being scored 0.6460177, the most similar ligand is CHEMBL3912914. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL3912914 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | O[C@H](C1CCCCC1)C(=O)N(CCN2[C@@H]3CC[C@H]2C[C@H](C3)c4cccc(O)c4)CC5CCCCC5 |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00010000 43003208 20100102 04010600 00080080 40000010 02000000 20000008 00000800 000808c0 08300000 5001d000 0400800a 00a02000 00180000 000c0008 10000000 02000000 02402000 00020201 00000100 38040610 03000001 02500018 00000000 80000000 00000000 10001000 08000002 0006000b 00020000 00002600 |