On Target CXCR4_HUMAN 0.5877193/CHEMBL365952
For the given ligand Lisinopril, we have found in our database that, being scored 0.5877193, the most similar ligand is CHEMBL365952. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL365952 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | NCCCC[C@H]1NC(=O)[C@@H](Cc2ccc(O)cc2)NC(=O)CNC(=O)[C@H](Cc3ccc4ccccc4c3)NC(=O)[C@H](CCCN=C(N)N)NC1=O |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 00010000 01003208 20100100 04010e00 00000002 00000000 02010000 2000000c 00200880 000808c2 08300010 4003b000 0600801a 00002009 80000000 00040008 00000800 02000000 00002008 00020201 00000100 38240638 00000003 83500018 00000800 80000000 40130000 10000000 0c000000 0006000b 20004000 00002600 |