On Target CNR2_HUMAN 0.5/CHEMBL472661
For the given ligand Captopril, we have found in our database that, being scored 0.5, the most similar ligand is CHEMBL472661. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL472661 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | CCCCCCCC\C=C/CCCCCCCC(=O)N[C@@H]1C[C@@H]1O |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 00010000 01005000 00100000 00000400 00000080 00000000 00000000 20000402 00000000 00100080 00200000 40011000 0402800a 01000000 00080400 00080008 10000000 00000000 00802000 00000201 00000000 10100610 03008080 00100018 00200001 00000000 00404000 90000000 00000000 00040001 24020000 00002200 |