On Target CNR2_HUMAN 0.6837607/CHEMBL1765277
For the given ligand Ramipril, we have found in our database that, being scored 0.6837607, the most similar ligand is CHEMBL1765277. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL1765277 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | CN1CCOC[C@H]1C(=O)N2CC[C@](O)([C@@H]3CCCC[C@H]23)c4ccccc4 |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00000000 01001200 00100102 84010600 000c0080 00204000 00000000 20000000 00000900 000808c0 08300000 5001b000 12008002 00a82002 00101008 000c0108 10200000 02000000 02c02000 00000201 00000120 38140630 13000081 02500018 10000401 80000000 00000000 10000001 08000202 0006000b 40024000 00002600 |