On Target NTRK1_HUMAN 0.2195122/CHEMBL539474
For the given ligand Captopril, we have found in our database that, being scored 0.2195122, the most similar ligand is CHEMBL539474. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL539474 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | O=C1CCCN1Cc2ccc3c(NC(=O)c4cccn34)c2 |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 00020022 00809800 00100100 00010600 00040040 00000050 00008006 22001000 06000000 400008e0 0c200004 40009000 84008802 00e00000 00940440 00040004 08000008 02000004 00200000 00000201 c0000080 18008600 21800000 80700018 00004000 c0000000 00008040 90000010 00400100 00060001 20048200 00800220 |