On Target NTRK1_HUMAN 0.41025642/CHEMBL3408947
For the given ligand Moexipril, we have found in our database that, being scored 0.41025642, the most similar ligand is CHEMBL3408947. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL3408947 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | COc1ccc2NC(=O)[C@@]3(C[C@H]3c4ccc5c(\C=C\c6ccc(CN7C[C@@H](C)O[C@@H](C)C7)cc6)n[nH]c5c4)c2c1 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 0001400a 43000208 2010010a 80010e00 21241085 c0042002 c3000080 0a001408 00100900 000808c0 08380124 40019000 8d008822 21700000 410a154b 000e210c 10248400 02000000 186a0008 00220201 41100100 1e308608 32802801 81710011 00102c00 c0000201 00562050 d0011081 04418304 0006000b 24042080 20406720 |