On Target MTOR_HUMAN 0.3923445/CHEMBL371029
For the given ligand Fosinopril, we have found in our database that, being scored 0.3923445, the most similar ligand is CHEMBL371029. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL371029 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | CO[C@H]1C[C@@H]2CC[C@@H](C)[C@@](O)(O2)C(=O)C(=O)N3CCCC[C@H]3C(=O)N[C@H](CCc4ccccc4)C(=O)NCC(=O)N(C)CC(=O)O[C@H]1C |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00010040 01007200 0010050a 84010700 802c00c0 00200000 00000800 20000048 04102800 010808e0 08302000 5001f000 1600800a 02a82001 80101008 082d1008 10a20000 82000000 11c02000 00000201 00000120 38040e10 17000083 0a50001c 10000401 80000000 00800000 30000021 08000200 0006000b 20a24000 00402600 |