On Target MTOR_HUMAN 0.3888889/CHEMBL3972399
For the given ligand Captopril, we have found in our database that, being scored 0.3888889, the most similar ligand is CHEMBL3972399. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL3972399 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | CCCNC(=O)CC[C@@]1(C)[C@@H](CC[C@]2(C)[C@@H]1C[C@@H](F)C34OC(=O)[C@@]5(CC[C@@H](C)[C@H](C)[C@@H]35)CC[C@@]24C)C(=C)C |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 00050040 01001000 00100100 00010700 00081400 00000000 00000004 20000400 00000000 00100080 00240000 40019000 0400800a 00800000 00080400 00081008 00820000 00400000 02402000 00000201 00000120 10000e10 01000000 00500018 00000400 00000000 00000020 90000000 00000200 02040003 24020000 00002600 |