On Target MTOR_HUMAN 0.65957445/CHEMBL371029
For the given ligand Ramipril, we have found in our database that, being scored 0.65957445, the most similar ligand is CHEMBL371029. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL371029 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | CO[C@H]1C[C@@H]2CC[C@@H](C)[C@@](O)(O2)C(=O)C(=O)N3CCCC[C@H]3C(=O)N[C@H](CCc4ccccc4)C(=O)NCC(=O)N(C)CC(=O)O[C@H]1C |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00010040 01007200 0010050a 84010700 802c00c0 00200000 00000800 20000048 04102800 010808e0 08302000 5001f000 1600800a 02a82001 80101008 082d1008 10a20000 82000000 11c02000 00000201 00000120 38040e10 17000083 0a50001c 10000401 80000000 00800000 30000021 08000200 0006000b 20a24000 00402600 |