On Target OPRX_HUMAN 0.51592356/CHEMBL3785728
For the given ligand Moexipril, we have found in our database that, being scored 0.51592356, the most similar ligand is CHEMBL3785728. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL3785728 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | Oc1ccc2CNC(CN3CCC4(CC3)CCc5ccccc45)Cc2c1 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 00000008 43000208 20100102 14010600 00000020 c0000002 02000000 22001001 00000880 000908c0 08300000 50018000 00000802 00203000 00000400 02060008 00000000 02000020 00002000 00020201 00020100 38208010 00004001 83500010 00000000 c0000001 00224000 90000000 0c000102 0086000a 20040000 00002600 |