On Target FYN_HUMAN 0.32017544/CHEMBL432649
For the given ligand Fosinopril, we have found in our database that, being scored 0.32017544, the most similar ligand is CHEMBL432649. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL432649 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | CC[C@H](C)[C@H](NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](CCC(=O)O)NC(=O)[C@H](Cc1ccc(OP(=O)(O)O)cc1)N\C=C\c2ccc(O)c(O)c2)C(=O)N[C@@H](CCC(=O)O)C(=O)O |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00630000 41007208 20100900 04010600 00180094 00080000 820240a0 20000408 08000c20 000a08c0 08300200 4061b000 06008032 03022001 80180000 000c8048 10000020 12004000 00400008 10020221 00200100 3c240e00 03000003 83500018 04000840 a0000000 02122000 10070500 0e400000 0046010b 24004000 2092ae00 |