On Target FYN_HUMAN 0.50980395/CHEMBL407135
For the given ligand Lisinopril, we have found in our database that, being scored 0.50980395, the most similar ligand is CHEMBL407135. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL407135 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | CCC(C)CCCC(=O)N[C@@H](CCN)C(=O)N[C@@H]([C@@H](C)O)C(=O)N[C@@H](CCN)C(=O)N[C@H]1CCNC(=O)[C@@H](NC(=O)[C@H](CCN)NC(=O)[C@H](CCN)NC(=O)[C@H](CC(C)C)NC(=O)[C@@H](CC(C)C)NC(=O)[C@H](CCN)NC1=O)[C@H](C)O |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 00030000 01007400 00100000 04000400 00000080 00000000 00000000 20000008 00200000 000001a0 00200000 40033000 1600800a 00002001 80180000 00080008 10000000 00000000 00802000 00000201 00000000 300c0610 03000083 02100018 00000001 00000000 00000000 10000000 08000000 00040011 20024000 00802200 |