On Target CAH2_HUMAN 0.5405405/CHEMBL3314178
For the given ligand Lisinopril, we have found in our database that, being scored 0.5405405, the most similar ligand is CHEMBL3314178. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL3314178 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | Cl.CC(=O)NC(CCCCN)C(=O)NCCc1ccc(cc1)S(=O)(=O)N |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 00010010 01803000 01100100 04b10600 00000008 00000000 00000000 2000000c 00000080 000808c0 08202000 6001b000 0600800a 00002001 80200000 00000000 00000000 02000000 00002000 00002201 80000000 38240630 00000001 8b500018 00000000 80000000 00000000 10000028 0c000000 20060003 20004000 00032620 |