On Target CDK5_HUMAN 0.26229507/CHEMBL422897
For the given ligand Fosinopril, we have found in our database that, being scored 0.26229507, the most similar ligand is CHEMBL422897. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL422897 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | CN1CCC(C(O)C1)c2c(O)cc(O)c3C(=O)C=C(Oc23)c4ccccc4Cl |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 0040a001 01200208 20180100 00010600 001002c1 80004120 02004000 74800200 02084b00 400808c0 08300011 51018940 42008406 00200088 000c0020 100c2208 18064020 06000840 0e400200 00820a01 00240100 18100128 13004000 00588010 08002000 80004201 041200b4 1b900040 a0106200 0186880a 40000040 00020e00 |