On Target CDK5_HUMAN 0.26436782/CHEMBL1994526
For the given ligand Captopril, we have found in our database that, being scored 0.26436782, the most similar ligand is CHEMBL1994526. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL1994526 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | CC(N)C1CCC(CC1)C(=O)Nc2ccncc2 |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 00010002 01000000 00104000 00000600 20040000 00002000 00008000 00000000 00000000 000000c0 00280004 40011000 04008808 00100000 00020000 00040004 00040000 00000000 02202000 00000001 40100000 18048610 20804000 00100010 00000000 00000000 00008000 10000080 00000000 00060001 00020000 00000240 |