On Target CDK5_HUMAN 0.39766082/CHEMBL1976240
For the given ligand Moexipril, we have found in our database that, being scored 0.39766082, the most similar ligand is CHEMBL1976240. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL1976240 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | COc1cccc(c1)C(CN)NC(=O)c2ccc(cc2)c3ccncc3 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 00002002 46802808 20004108 40010600 00041000 80000000 02000000 02001000 00000100 00090840 08200004 60008000 80008802 20000000 01000401 0004000c 00022000 02000000 04280000 10020200 c0000000 38028600 30800000 8344801c 00000000 c0000000 00000000 80000040 0c004300 00060003 80040000 00000620 |