On Target ESR1_HUMAN 0.4/CHEMBL4075710
For the given ligand Fosinopril, we have found in our database that, being scored 0.4, the most similar ligand is CHEMBL4075710. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL4075710 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | C[C@]12CC[C@H]3[C@@H](CCc4cc(O)ccc34)[C@@H]1CC[C@@H]2OC(=O)[C@@H]5CCCN5C(=O)c6ccc(cc6)S(=O)(=O)N |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00018058 43805808 21100102 80b10700 00080088 40000012 02000000 22001001 00000800 000808c0 08302000 6001b000 06008812 01a00001 80281428 00081008 10820200 02000001 02402000 00022201 80000120 180e8e00 13004000 0850001c 10000400 c0000001 00920000 90000029 00000302 21060003 a0064000 00010620 |