On Target ESR1_HUMAN 0.54901963/CHEMBL4075710
For the given ligand Ramipril, we have found in our database that, being scored 0.54901963, the most similar ligand is CHEMBL4075710. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL4075710 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | C[C@]12CC[C@H]3[C@@H](CCc4cc(O)ccc34)[C@@H]1CC[C@@H]2OC(=O)[C@@H]5CCCN5C(=O)c6ccc(cc6)S(=O)(=O)N |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00018058 43805808 21100102 80b10700 00080088 40000012 02000000 22001001 00000800 000808c0 08302000 6001b000 06008812 01a00001 80281428 00081008 10820200 02000001 02402000 00022201 80000120 180e8e00 13004000 0850001c 10000400 c0000001 00920000 90000029 00000302 21060003 a0064000 00010620 |