On Target 5HT2C_HUMAN 0.320442/CHEMBL1276859
For the given ligand Fosinopril, we have found in our database that, being scored 0.320442, the most similar ligand is CHEMBL1276859. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL1276859 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | OC(=O)CC1CCN(C1)C2CC[C@@]3(C2)Cc4ccccc4Cc5ccccc35 |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00030000 01000200 00100102 00010600 00180000 00000012 00000400 21000001 04100800 000808c0 08300000 40019000 04008012 01200000 00000020 020c0008 00000000 02000000 00502000 00000201 00000100 18100a10 01404000 00500810 00000000 a0000001 00000000 50000000 02000082 0106000a 00020000 00802f00 |