On Target 5HT2C_HUMAN 0.5825243/CHEMBL1092029
For the given ligand Lisinopril, we have found in our database that, being scored 0.5825243, the most similar ligand is CHEMBL1092029. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL1092029 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | O=C(NCc1ccc(cc1)C2CCCCC2)[C@@H]3CCCN3 |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 00010000 01800000 00100102 04010600 00000000 00000010 00000000 22001000 00000900 000908c0 08300000 4001b800 86008812 00202000 80000400 00000000 00000000 02000000 02002000 00000201 80000100 38008620 00000001 02500018 00000000 c0000000 00000000 90000000 08000102 00060003 20064000 00000600 |