On Target PTGES_HUMAN 0.3846154/CHEMBL4071976
For the given ligand Ramipril, we have found in our database that, being scored 0.3846154, the most similar ligand is CHEMBL4071976. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL4071976 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | OC(=O)c1ccccc1CC[C@@H]2CCC[C@@H]2NC(=O)C3CCN(CC3)c4ccc(cc4)C(F)(F)F |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00024002 01001800 00100102 00010600 20000000 0000e000 00000400 20000000 00300900 000808d0 08300004 50039800 04008002 01208000 00020060 00080008 00040000 02000000 08002000 00000201 40500500 18060e70 20004000 0050001c 00000000 80000201 00000200 90000080 00008002 01060003 c0120000 00802600 |