On Target MIF_HUMAN 0.18987341/CHEMBL554271
For the given ligand Captopril, we have found in our database that, being scored 0.18987341, the most similar ligand is CHEMBL554271. Check out the elaboration below.
| Captopril (Given Ligand) | CHEMBL554271 (Similar Ligand) |
|---|---|
| C[C@H](CS)C(=O)N1CCC[C@H]1C(=O)O | Oc1ccc(cc1F)C2=NOC(CCN3C(=O)c4ccccc4C3=O)C2 |
|
|
|
|
|
|
| 00010000 01005000 00100000 00100400 00080080 00000010 00000000 20000000 00000000 00000080 00200000 40013000 06008012 01040000 80080000 00080008 10000000 00000000 00400000 00400201 40000000 10040e00 03000200 00100018 00000000 00000000 00000000 10000000 00000000 00040021 20004000 01012200 | 00000000 01801808 20900102 12050e00 02000000 10048010 020000c0 22003000 00108948 000828c1 08310000 50018000 80008802 00201000 00000408 00090018 00002800 02000000 00d06000 00820601 80020100 38168690 010010c2 0050001c 00000001 c0220004 e0124000 92000001 0018c10a 00068003 e00c0000 00000600 |