On Target MIF_HUMAN 0.32704404/CHEMBL497598
For the given ligand Ramipril, we have found in our database that, being scored 0.32704404, the most similar ligand is CHEMBL497598. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL497598 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | CC(C)(C)OC(=O)C[C@H]1CC(=NO1)c2ccc(O)c(F)c2 |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 00010000 01000008 20900102 02050b00 02080040 10440010 02000040 00002000 00108948 03092851 08110000 50009000 9400880a 00a01000 00000008 00091018 00820800 02000000 01406000 00860441 00000120 28008a00 01001042 00400010 00000400 80020004 e0120000 02000001 0010420a 00028002 40080000 00000600 |