On Target MIF_HUMAN 0.3212121/CHEMBL554271
For the given ligand Lisinopril, we have found in our database that, being scored 0.3212121, the most similar ligand is CHEMBL554271. Check out the elaboration below.
| Lisinopril (Given Ligand) | CHEMBL554271 (Similar Ligand) |
|---|---|
| NCCCC[C@H](N[C@@H](CCc1ccccc1)C(=O)O)C(=O)N2CCC[C@H]2C(=O)O | Oc1ccc(cc1F)C2=NOC(CCN3C(=O)c4ccccc4C3=O)C2 |
|
|
|
|
|
|
| 00010000 01005200 00100102 04010600 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01202003 80180000 000c0008 10000000 02000000 00402000 00000201 00000100 38040e30 03000001 02500018 00000000 80000000 00000000 10000000 08000000 0006000b 20004000 00402600 | 00000000 01801808 20900102 12050e00 02000000 10048010 020000c0 22003000 00108948 000828c1 08310000 50018000 80008802 00201000 00000408 00090018 00002800 02000000 00d06000 00820601 80020100 38168690 010010c2 0050001c 00000001 c0220004 e0124000 92000001 0018c10a 00068003 e00c0000 00000600 |