On Target 5HT2B_HUMAN 0.31868133/CHEMBL1255837
For the given ligand Fosinopril, we have found in our database that, being scored 0.31868133, the most similar ligand is CHEMBL1255837. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL1255837 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | CC(C)[C@@]1(NC(=O)[C@@H]2C[C@H]3[C@@H](Cc4c[nH]c5cccc3c45)N(C)C2)O[C@@]6(O)[C@@H]7CCCN7C(=O)[C@H](Cc8ccccc8)N6C1=O.CS(=O)(=O)O |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 02010042 21c07e00 00100102 c5d10710 000c1180 00038010 00023800 a000020c 00d00a80 000909e0 08302004 5001f000 be00881e 01602b03 80181048 183e100c 10800040 82080004 00602d18 00000201 40000120 382486f8 33800023 9350003c 30043c00 80081002 18800040 30a00021 0c400202 0006001b a0064200 00412620 |