On Target HRH1_HUMAN 0.3227513/CHEMBL1277311
For the given ligand Fosinopril, we have found in our database that, being scored 0.3227513, the most similar ligand is CHEMBL1277311. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL1277311 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | OC(=O)[C@@H]1CCCN(C1)C2CCC3(C2)Cc4ccccc4Oc5ccccc35 |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00010000 01000208 2010010a 00018600 00081000 00000000 02000000 20000200 00100804 000a08c0 08340000 50019040 0c008012 01200000 01000001 000c2008 40000000 02000000 00c02010 00020201 00400100 18100a10 01000080 00500410 00001001 c0000000 00000000 10200000 00000302 0106c00a 00020400 00002700 |