On Target HRH1_HUMAN 0.49358973/CHEMBL3817898
For the given ligand Moexipril, we have found in our database that, being scored 0.49358973, the most similar ligand is CHEMBL3817898. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL3817898 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | COc1ccc(cc1)C(=O)CCCN2CCc3ccccc3C2 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 00020008 01000808 2010010b 10010600 00001020 00000000 02040000 22001000 00100880 000808c0 08300000 40019000 04008882 00200000 01000401 00000008 00000200 02000020 00000000 00020201 00020100 18228200 00004000 81500014 00000000 c0000000 00124000 90000000 04000300 00060002 a0040000 00802600 |