On Target NMDE1_HUMAN 0.18134715/CHEMBL284237
For the given ligand Fosinopril, we have found in our database that, being scored 0.18134715, the most similar ligand is CHEMBL284237. Check out the elaboration below.
| Fosinopril (Given Ligand) | CHEMBL284237 (Similar Ligand) |
|---|---|
| CCC(=O)O[C@@H](OP(=O)(CCCCc1ccccc1)CC(=O)N3C[C@H](C2CCCCC2)C[C@H]3C(=O)O)C(C)C | C[C@]12N[C@H](Cc3ccccc13)c4ccccc24 |
|
|
|
|
|
|
| 00010440 03005208 0010050a 00050e20 00080081 00000010 00004900 30000000 0000c800 000808e0 09300001 4011b000 0600801a 01a200b0 82095000 20281608 100a0028 02100003 c2406010 00000201 01004120 19562e10 03c00000 80508218 00002402 80000100 22000400 38214000 008c0200 01060303 30864000 0000c621 | 00000008 00000000 00100100 10010600 00000020 00000002 00000400 03001001 04000880 00080840 08300000 40808000 00000802 00200000 00000400 00000080 00002000 02000020 00100000 00000201 00020100 18308000 00404000 81400810 00000000 e0200001 00004000 c0000000 06000180 00860002 20040000 00000700 |