On Target IKKB_HUMAN 0.3312102/CHEMBL3917180
For the given ligand Moexipril, we have found in our database that, being scored 0.3312102, the most similar ligand is CHEMBL3917180. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL3917180 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | NC(=O)c1nn(c2ccc3OCOc3c2)c4c1CCc5ccc(NC(=O)c6cc(CCN7CCOCC7)ncc6Cl)cc45 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 0400e00e c2001a09 e01841a8 d0810e10 050e10a0 4c01c002 73642001 0000140c 00200984 40090ad0 59398024 6090e808 8780c83a 68308202 210a184d 0a2ca10c 10060008 8f801000 8c68050a 00220601 40540b00 1835a760 32c16800 8b40c01c 50a45c10 c0180241 18260240 a00008f1 1540c384 50c6000b c80e8200 a30307a2 |