On Target IKKB_HUMAN 0.37724552/CHEMBL2208034
For the given ligand Ramipril, we have found in our database that, being scored 0.37724552, the most similar ligand is CHEMBL2208034. Check out the elaboration below.
| Ramipril (Given Ligand) | CHEMBL2208034 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3[C@H](C(=O)O)C[C@@H]2CCC[C@@H]23 | O=C(Nc1ccc(cc1)c2ccnc(Nc3ccc(cc3)N4CCOCC4)n2)[C@H]5CCCN5 |
|
|
|
|
|
|
| 00010000 01005200 00100102 84010700 00080080 00000010 00000000 20000000 00000800 000808c0 08302000 4001b000 0600801a 01a02003 80181008 000c1008 10820000 02000000 00402000 00000201 00000120 38040e10 13000001 02500018 00000400 80000000 00000000 10000001 08000200 0106000b 20024000 00402600 | 0001e002 01001800 80101120 84050600 21000084 00006010 00002000 00080000 00000100 00000ac0 002d0004 6001b800 06008012 0010a000 80021048 000c010c 10060000 12006000 0c400000 10a00201 40100000 3c062620 32802841 0250011a 00000400 80000000 08000000 100100e0 0800c20c 00460801 40004800 000002a2 |