On Target MK03_HUMAN 0.3463687/CHEMBL3113587
For the given ligand Moexipril, we have found in our database that, being scored 0.3463687, the most similar ligand is CHEMBL3113587. Check out the elaboration below.
| Moexipril (Given Ligand) | CHEMBL3113587 (Similar Ligand) |
|---|---|
| CCOC(=O)[C@H](CCc1ccccc1)N[C@@H](C)C(=O)N3Cc2cc(OC)c(OC)cc2C[C@H]3C(=O)O | CCCCCCCCCC(NC(=O)CNC(=O)OCc1ccccc1)C(=O)NCCc2ccccc2 |
|
|
|
|
|
|
| 00018008 47805208 2010010a 94010700 000810a0 c0000000 03041000 22001004 00000880 000908c0 08302000 4000b000 0600c882 20202003 81181489 000c9008 10820200 02000020 00480008 00020201 80020120 38208e00 13004041 83448018 00000c00 c0000001 00324000 90000001 0c000300 0086000b 20044000 00402600 | 01010000 01403000 00100100 04010600 00000000 00014000 00000000 2000000c 00800380 000808c0 08200000 4001b000 0e00800a 00012001 00000000 021a0008 00020000 02000400 00002890 00000201 00000000 38240e30 00000003 83500018 00000000 80002002 00000000 10200020 0c000200 00060003 e0024000 00002600 |