On Target TNFA_HUMAN 0.29464287/CHEMBL306090
For the given ligand Fenbufen, we have found in our database that, being scored 0.29464287, the most similar ligand is CHEMBL306090. Check out the elaboration below.
| Fenbufen (Given Ligand) | CHEMBL306090 (Similar Ligand) |
|---|---|
| O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | CNC(=O)[C@@H](NC(=O)[C@@H]([C@H](CO)C(=O)NO)c1ccc(C)cc1)C(C)(C)C |
|
|
|
|
|
|
| 00052000 01000800 00000102 40010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40009800 04008000 00200000 00000000 00080008 00020000 02000000 04400000 10000001 00000100 08020a00 11000000 00400014 00000000 80000000 00000000 00000040 00004002 00020002 80000000 00400400 | 00060000 00003210 40100100 04010600 00100000 00000000 08000000 20000008 00200980 000808c0 08300000 4002b800 17008016 00002000 c0000000 00080018 00000000 02000000 00c00008 00040201 00000100 38200600 01000041 83400018 00002800 80000000 00000000 10000000 0c000002 0006000f 20006000 02802e00 |