Job #148 - Fenbufen+Celecoxib+Diclofenac
Created at: Last updated at: Current status:
Overall Progress
|
|
Ligand Models 1
| Name | Fenbufen |
| 2D and 3D depictions |
|
| SMILES | O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 |
| Model downloads | |
| Fingerprints | |
Ligand Models 2
| Name | Celecoxib |
| 2D and 3D depictions |
|
| SMILES | Cc3ccc(c1cc(C(F)(F)F)nn1c2ccc(S(N)(=O)=O)cc2)cc3 |
| Model downloads | |
| Fingerprints | |
Ligand Models 3
| Name | Diclofenac |
| 2D and 3D depictions |
|
| SMILES | O=C(O)Cc1ccccc1Nc2c(Cl)cccc2Cl |
| Model downloads | |
| Fingerprints | |