On Target SCN9A_HUMAN 0.36633664/CHEMBL206758
For the given ligand Fenbufen, we have found in our database that, being scored 0.36633664, the most similar ligand is CHEMBL206758. Check out the elaboration below.
| Fenbufen (Given Ligand) | CHEMBL206758 (Similar Ligand) |
|---|---|
| O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | OC(CCc1ccccc1)[C@@H]2CCC[C@H]2C(=O)NCc3cc(Cl)cc(Cl)c3 |
|
|
|
|
|
|
| 00052000 01000800 00000102 40010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40009800 04008000 00200000 00000000 00080008 00020000 02000000 04400000 10000001 00000100 08020a00 11000000 00400014 00000000 80000000 00000000 00000040 00004002 00020002 80000000 00400400 | 00058000 09800000 00100102 00010600 00180000 00000020 04000000 22001000 00000800 000808c8 08300000 40019800 0600880e 00a00400 80000400 00080008 00000000 02000000 00402000 00000201 80000100 18008710 01000040 00500018 00002000 c0000000 00000000 90000000 00000102 01060003 20060000 00020e00 |