On Target DRD4_HUMAN 0.45/CHEMBL1258270
For the given ligand Fenbufen, we have found in our database that, being scored 0.45, the most similar ligand is CHEMBL1258270. Check out the elaboration below.
| Fenbufen (Given Ligand) | CHEMBL1258270 (Similar Ligand) |
|---|---|
| O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | Cc1ccc(C)c(c1)C2CCN(CCCC(=O)c3cc(C)ccc3C)CC2 |
|
|
|
|
|
|
| 00052000 01000800 00000102 40010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40009800 04008000 00200000 00000000 00080008 00020000 02000000 04400000 10000001 00000100 08020a00 11000000 00400014 00000000 80000000 00000000 00000040 00004002 00020002 80000000 00400400 | 00020000 01000a00 00100102 00010600 00000001 00008000 00000000 20000000 00100900 000808c0 08300000 50019000 04008002 00200000 00000020 0a0c0008 00000000 02000000 00000000 00000201 00000100 18020200 01004000 00500014 00000000 80000001 00000000 10000000 00000000 0006000a 80000000 00802600 |