On Target PERM_HUMAN 0.31527093/CHEMBL3633251
For the given ligand Celecoxib, we have found in our database that, being scored 0.31527093, the most similar ligand is CHEMBL3633251. Check out the elaboration below.
| Celecoxib (Given Ligand) | CHEMBL3633251 (Similar Ligand) |
|---|---|
| Cc3ccc(c1cc(C(F)(F)F)nn1c2ccc(S(N)(=O)=O)cc2)cc3 | COc1ccc(C2=CC(=O)NC(=S)N2CCO)c(OC)c1 |
|
|
|
|
|
|
| 00006036 00802208 a1100100 00b10600 01080010 00004002 00440400 00001400 00000104 000108f0 0900a004 6000800a 00000810 02000201 80200040 000c200c 00020000 02801000 04400000 10222008 c0100000 1801a020 30800800 8b404008 00000000 c0000040 30c20000 90000869 04004104 20460008 40260200 800126a2 | 0005e003 00004808 a0100108 00050600 20081000 00004040 42040000 00082c00 06000100 800a08e0 8801000c 60018800 02009032 00d00000 01220081 000c620c 80060000 0300a104 04400020 00030800 80100000 18020000 b3802045 0450c108 00000000 c0000000 30020020 00040070 00004304 10470010 40080c00 000100a8 |