|
Name | Etoricoxib |
2D and 3D depictions |
|
SMILES | Cc3ccc(c1ncc(Cl)cc1c2ccc(S(C)(=O)=O)cc2)cn3 |
Model downloads | |
Fingerprints |
Name | Indomethacin |
2D and 3D depictions |
|
SMILES | COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c3ccc(Cl)cc3 |
Model downloads | |
Fingerprints |
Name | Fenbufen |
2D and 3D depictions |
|
SMILES | O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 |
Model downloads | |
Fingerprints |
Name | Celecoxib |
2D and 3D depictions |
|
SMILES | Cc3ccc(c1cc(C(F)(F)F)nn1c2ccc(S(N)(=O)=O)cc2)cc3 |
Model downloads | |
Fingerprints |
Name | Diclofenac |
2D and 3D depictions |
|
SMILES | O=C(O)Cc1ccccc1Nc2c(Cl)cccc2Cl |
Model downloads | |
Fingerprints |