On Target TRPV1_RAT 0.5053192/CHEMBL438345
For the given ligand Indomethacin, we have found in our database that, being scored 0.5053192, the most similar ligand is CHEMBL438345. Check out the elaboration below.
| Indomethacin (Given Ligand) | CHEMBL438345 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c3ccc(Cl)cc3 | Cn1c2CCCC(CNC(=O)c3ccc(OC(F)(F)F)cc3)c2c4cc(O)ccc14 |
|
|
|
|
|
|
| 0000800a 00000a08 20100188 50010718 00045060 00000000 060c2000 00001000 80500000 000808c0 08000004 4001b800 03008866 00608000 c10e0041 020c000c 18810000 83800004 01280400 00020200 40000000 18028f18 21804000 81500014 00042000 c0000100 08160000 10000000 04000204 0006084b 80042200 00020420 | 0000000a 01005808 2010110b 51810610 00045130 00000002 07042000 22001105 00400880 000908c0 08308004 40c18000 18008806 00608800 01020441 0a04000c 00000200 86800004 00202408 00020201 40100100 18268618 20804009 9150041c 00042000 c0000001 08320000 d0000080 06000306 00860043 a0040200 20000620 |