On Target AMPN_HUMAN 0.44660193/CHEMBL1077591
For the given ligand Indomethacin, we have found in our database that, being scored 0.44660193, the most similar ligand is CHEMBL1077591. Check out the elaboration below.
| Indomethacin (Given Ligand) | CHEMBL1077591 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c3ccc(Cl)cc3 | CC[C@H](C)[C@H](NC(=O)[C@H](Cc1ccc(O)cc1)NC(=O)[C@@H](N)C(C)C)C(=O)N[C@H]2Cc3c(CN(CC(=O)N[C@@H](Cc4ccccc4)C(=O)O)C2=O)[nH]c5ccccc35 |
|
|
|
|
|
|
| 0000800a 00000a08 20100188 50010718 00045060 00000000 060c2000 00001000 80500000 000808c0 08000004 4001b800 03008866 00608000 c10e0041 020c000c 18810000 83800004 01280400 00020200 40000000 18028f18 21804000 81500014 00042000 c0000100 08160000 10000000 04000204 0006084b 80042200 00020420 | 0001800a 0180fa08 20100100 55810e10 000412a0 00100000 03002000 2200300d 00400880 000908c0 08310004 4001b000 1e008882 0060a801 801204c0 020c010c 10000200 02000006 00600408 00020a01 c0020100 38278e08 23804043 93500018 00143880 c0000001 08124000 90000000 0c000104 0186000b 20044200 00006620 |