On Target PDE4B_HUMAN 0.39130434/CHEMBL253083
For the given ligand Fenbufen, we have found in our database that, being scored 0.39130434, the most similar ligand is CHEMBL253083. Check out the elaboration below.
| Fenbufen (Given Ligand) | CHEMBL253083 (Similar Ligand) |
|---|---|
| O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | CC(C)(c1cc(c2cccc(c2)c3ccc(cc3)C4CC4C(=O)O)c5ncccc5c1)S(=O)(=O)C |
|
|
|
|
|
|
| 00052000 01000800 00000102 40010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40009800 04008000 00200000 00000000 00080008 00020000 02000000 04400000 10000001 00000100 08020a00 11000000 00400014 00000000 80000000 00000000 00000040 00004002 00020002 80000000 00400400 | 00012002 05004020 00006502 00110210 000c1001 04000008 20000004 00000000 00000900 00084844 08102004 40009800 04809800 41640000 80000040 800c000c 04020018 02001104 04600008 10080001 40040100 08008a08 31800040 80404010 00040801 80080080 18000200 00000041 00404000 00020002 00040000 00410420 |