On Target OPRK_HUMAN 0.5443038/CHEMBL2022019
For the given ligand Fenbufen, we have found in our database that, being scored 0.5443038, the most similar ligand is CHEMBL2022019. Check out the elaboration below.
| Fenbufen (Given Ligand) | CHEMBL2022019 (Similar Ligand) |
|---|---|
| O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | COC(=O)[C@@H]1C[C@H](OC(=O)C)C(=O)[C@H]2[C@@]1(C)CC[C@H]3C(=O)O[C@@H](C[C@]23C)C(=O)c4ccccc4 |
|
|
|
|
|
|
| 00052000 01000800 00000102 40010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40009800 04008000 00200000 00000000 00080008 00020000 02000000 04400000 10000001 00000100 08020a00 11000000 00400014 00000000 80000000 00000000 00000040 00004002 00020002 80000000 00400400 | 00050040 01000800 00000102 00010300 80280040 00000000 00000000 00000040 00000800 000a0840 08100000 4000d000 04008028 00a00000 00040000 08081008 08820000 82000100 16402000 00000001 00010120 08020a00 01000000 00400014 00000400 80000000 00000000 00000000 00000202 00020002 80020000 02000400 |