On Target ALDR_HUMAN 0.443038/CHEMBL51483
For the given ligand Fenbufen, we have found in our database that, being scored 0.443038, the most similar ligand is CHEMBL51483. Check out the elaboration below.
| Fenbufen (Given Ligand) | CHEMBL51483 (Similar Ligand) |
|---|---|
| O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | CC(C)c1c(O)c(O)c(C=O)c2c(O)c(c(C)cc12)c3c(C)cc4c(C(C)C)c(O)c(O)c(C=O)c4c3O |
|
|
|
|
|
|
| 00052000 01000800 00000102 40010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40009800 04008000 00200000 00000000 00080008 00020000 02000000 04400000 10000001 00000100 08020a00 11000000 00400014 00000000 80000000 00000000 00000040 00004002 00020002 80000000 00400400 | 00002000 42000809 20000100 40010200 00000001 28020000 02000000 00000200 00000100 00080840 08000000 40008800 00008002 00200000 20000000 2000a008 00020000 02000000 04000000 10220a00 00000000 08020208 10000000 00404014 00000000 80000000 101a0000 00000040 00004000 00020002 80000200 00000400 |