On Target P2Y12_HUMAN 0.42727274/CHEMBL3325895
For the given ligand Indomethacin, we have found in our database that, being scored 0.42727274, the most similar ligand is CHEMBL3325895. Check out the elaboration below.
| Indomethacin (Given Ligand) | CHEMBL3325895 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c3ccc(Cl)cc3 | CCCC(=O)c1cnn(c1C)c2ccc(OC(=O)c3cn(CC(=O)N4CCN(C)CC4)c5ccc(Cl)cc35)cc2 |
|
|
|
|
|
|
| 0000800a 00000a08 20100188 50010718 00045060 00000000 060c2000 00001000 80500000 000808c0 08000004 4001b800 03008866 00608000 c10e0041 020c000c 18810000 83800004 01280400 00020200 40000000 18028f18 21804000 81500014 00042000 c0000100 08160000 10000000 04000204 0006084b 80042200 00020420 | 04008006 43803e08 2008018a 44810610 010c1100 4000c102 02042000 0000100c 10600900 000908c0 01200004 4001b800 0680888e 20612200 01010c61 0e0c200c 00020001 c2880000 00690100 00220801 c0000000 38078f78 30804822 83d0101e 08046000 c0002041 08060000 10000000 0c000684 10460019 c0040200 930206a0 |