On Target CXCR1_HUMAN 0.30952382/CHEMBL191413
For the given ligand Fenbufen, we have found in our database that, being scored 0.30952382, the most similar ligand is CHEMBL191413. Check out the elaboration below.
| Fenbufen (Given Ligand) | CHEMBL191413 (Similar Ligand) |
|---|---|
| O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | CC(C)Cc1ccc(cc1)[C@@H](C)C(=O)NS(=O)(=O)C |
|
|
|
|
|
|
| 00052000 01000800 00000102 40010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40009800 04008000 00200000 00000000 00080008 00020000 02000000 04400000 10000001 00000100 08020a00 11000000 00400014 00000000 80000000 00000000 00000040 00004002 00020002 80000000 00400400 | 00000040 20000000 00000100 01310600 00000000 00000000 00010000 00001000 00000900 00480840 08102000 40009800 01008001 00000001 c0000000 00000000 02000000 02000000 00000000 00004001 00000100 18000600 00000000 91400010 02000000 80000000 00000000 0000000c 04000000 00060002 00002000 00010660 |