On Target CXCR1_HUMAN 0.2460733/CHEMBL3342269
For the given ligand Etoricoxib, we have found in our database that, being scored 0.2460733, the most similar ligand is CHEMBL3342269. Check out the elaboration below.
| Etoricoxib (Given Ligand) | CHEMBL3342269 (Similar Ligand) |
|---|---|
| Cc3ccc(c1ncc(Cl)cc1c2ccc(S(C)(=O)=O)cc2)cn3 | OB(O)c1ccccc1CSc2ccc(cn2)C(=O)Nc3ccc(F)cc3 |
|
|
|
|
|
|
| 0002a002 00811201 00024100 10910210 00041020 04000008 01000001 00480004 00000100 10000850 0000a084 60008810 06004808 00210000 a0220000 820c0004 04020000 02003004 04200008 10402006 c0000000 08008100 31800000 08400009 00040803 80080200 08040240 00000060 0040c004 00020400 00000820 01030020 | 10004202 0180da00 001265a2 0231a611 01041000 00000010 00004100 02001000 00020000 00004840 01688004 6000c004 00009800 40151000 00201040 00040004 14040008 03000105 08200020 00200000 e0100000 084c8e00 20812000 0068000d 00040000 d0008000 08008000 80000081 00408114 00068005 90000000 80010260 |