On Target PGH2_HUMAN 0.5714286/CHEMBL441414
For the given ligand Fenbufen, we have found in our database that, being scored 0.5714286, the most similar ligand is CHEMBL441414. Check out the elaboration below.
| Fenbufen (Given Ligand) | CHEMBL441414 (Similar Ligand) |
|---|---|
| O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | C[C@H](C(=O)O)c1ccc(C[C@H]2CCC[C@@H]2O)cc1 |
|
|
|
|
|
|
| 00052000 01000800 00000102 40010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40009800 04008000 00200000 00000000 00080008 00020000 02000000 04400000 10000001 00000100 08020a00 11000000 00400014 00000000 80000000 00000000 00000040 00004002 00020002 80000000 00400400 | 00000000 01000000 00000102 00010200 00080040 00000000 00000000 00000000 00000900 00080840 08100000 40009800 01008000 00a00000 40040000 00080008 08000000 02000000 00402000 00000001 00000100 08000a00 01000040 00400010 00000000 80000000 00000000 00000000 00000002 01020002 00022000 00000400 |