On Target 5HT1B_HUMAN 0.62857145/CHEMBL263700
For the given ligand Indomethacin, we have found in our database that, being scored 0.62857145, the most similar ligand is CHEMBL263700. Check out the elaboration below.
| Indomethacin (Given Ligand) | CHEMBL263700 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c3ccc(Cl)cc3 | CN(C)CCc1cn(C(=O)c2ccccc2)c3ccc(O)cc13 |
|
|
|
|
|
|
| 0000800a 00000a08 20100188 50010718 00045060 00000000 060c2000 00001000 80500000 000808c0 08000004 4001b800 03008866 00608000 c10e0041 020c000c 18810000 83800004 01280400 00020200 40000000 18028f18 21804000 81500014 00042000 c0000100 08160000 10000000 04000204 0006084b 80042200 00020420 | 00000002 00000a08 20100180 41010718 00045000 00000000 06002000 00001000 00500000 000908c0 08200004 4001a000 10008826 00400000 00000040 0004000c 00810000 82800000 01200400 00020000 40000000 18228618 20800001 91500014 00042000 80000000 08120000 10000000 04000000 0006000b 80040200 00000620 |