On Target CNR2_HUMAN 0.625/CHEMBL234014
For the given ligand Fenbufen, we have found in our database that, being scored 0.625, the most similar ligand is CHEMBL234014. Check out the elaboration below.
| Fenbufen (Given Ligand) | CHEMBL234014 (Similar Ligand) |
|---|---|
| O=C(O)CCC(=O)c2ccc(c1ccccc1)cc2 | COC(=O)CCC(C)(C)c1ccc(c(O)c1)c2cc(C)cc(C)c2 |
|
|
|
|
|
|
| 00052000 01000800 00000102 40010200 00080000 00000000 00000000 00000000 00000900 00080840 08100000 40009800 04008000 00200000 00000000 00080008 00020000 02000000 04400000 10000001 00000100 08020a00 11000000 00400014 00000000 80000000 00000000 00000040 00004002 00020002 80000000 00400400 | 00012000 43000008 20000102 00010300 00080001 40000000 02000000 00000000 00000900 00080840 08100000 40009800 04408002 00200000 00000000 00082008 00820000 02001000 04400000 10020201 00000100 08000a00 11000000 00404010 00000000 80000000 10000000 00000041 00004200 00020002 00000200 00400400 |