On Target CNR2_HUMAN 0.9270073/CHEMBL72324
For the given ligand Indomethacin, we have found in our database that, being scored 0.9270073, the most similar ligand is CHEMBL72324. Check out the elaboration below.
| Indomethacin (Given Ligand) | CHEMBL72324 (Similar Ligand) |
|---|---|
| COc1ccc2c(c1)c(CC(=O)O)c(C)n2C(=O)c3ccc(Cl)cc3 | COC(=O)Cc1c(C)n(C(=O)c2cccc3ccccc23)c4ccc(OC)cc14 |
|
|
|
|
|
|
| 0000800a 00000a08 20100188 50010718 00045060 00000000 060c2000 00001000 80500000 000808c0 08000004 4001b800 03008866 00608000 c10e0041 020c000c 18810000 83800004 01280400 00020200 40000000 18028f18 21804000 81500014 00042000 c0000100 08160000 10000000 04000204 0006084b 80042200 00020420 | 0000800a 00000a08 20100188 50010718 00045060 00000000 060c2000 00001040 80500000 000838c0 08000004 4001b000 03008826 00608000 c10e0041 020c000c 18830000 83800004 05280400 00020200 40000000 18028e18 21804000 81500014 00042000 c0000100 08120000 10000000 04000204 0006084b 80042200 00000420 |